ChemNet > CAS > 43020-12-8 1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one
43020-12-8 1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one
Nama produk |
1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one |
Sinonim |
1-[5-(4-chlorophenyl)-2-methylfuran-3-yl]ethanone |
Nama Inggeris |
1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one;1-[5-(4-chlorophenyl)-2-methylfuran-3-yl]ethanone |
MF |
C13H11ClO2 |
Berat Molekul |
234.6782 |
InChI |
InChI=1/C13H11ClO2/c1-8(15)12-7-13(16-9(12)2)10-3-5-11(14)6-4-10/h3-7H,1-2H3 |
CAS NO |
43020-12-8 |
Struktur Molekul |
|
Kepadatan |
1.189g/cm3 |
Titik lebur |
114℃ |
Titik didih |
346.1°C at 760 mmHg |
Indeks bias |
1.55 |
Titik nyala |
163.1°C |
Tekanan wap |
5.88E-05mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|